| Identification | |
| Name: | 2H-1,3-Benzoxazine-2,4(3H)-dione,6-chloro- |
| Synonyms: | 6-Chloro-1,3-benzoxazine-2,4-dione;6-Chloro-2H-1,3-Benzoxazine-2,4(3H)-dione |
| CAS: | 24088-81-1 |
| EINECS: | 225-255-7 |
| Molecular Formula: | C8H4 Cl N O3 |
| Molecular Weight: | 197.57 |
| InChI: | InChI=1/C8H4ClNO3/c9-4-1-2-6-5(3-4)7(11)10-8(12)13-6/h1-3H,(H,10,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.54g/cm3 |
| Refractive index: | 1.6 |
| Specification: |
2H-1,3-Benzoxazine-2,4(3H)-dione,6-fluoro- , with CAS number of 24088-81-1, can be called 6-Chloro isatinic anhydride ; 6-chloroindole-2,3-dione ; 6-chloro isatin anhydride ; 6-chloro-2,3-indolinedione ; buttpark 50\07-92;6-chloro-1h-benzo[d][1,3]oxazine-2,4-dione . |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
