Identification |
Name: | Alanine, N,N-diethyl-,2,6-dimethoxyphenyl ester, hydrochloride, L- (7CI,8CI) |
Synonyms: | FC 650;L-N,N-Diethylalanine 2,6-dimethoxyphenyl ester hydrochloride;ALANINE, N,N-DIETHYL-, 2,6-DIMETHOXYPHENYL ESTER, L-, HYDROCHLORIDE;AC1L294N;LS-16033;[1-(2,6-dimethoxyphenoxy)-1-oxopropan-2-yl]-diethylazanium chloride;2409-35-0 |
CAS: | 2409-35-0 |
Molecular Formula: | C15H23 N O4 . Cl H |
Molecular Weight: | 317.85 |
InChI: | InChI=1/C15H23NO4.ClH/c1-6-16(7-2)11(3)15(17)20-14-12(18-4)9-8-10-13(14)19-5;/h8-11H,6-7H2,1-5H3;1H |
Molecular Structure: |
 |
Properties |
Flash Point: | 154.7°C |
Boiling Point: | 332.1°Cat760mmHg |
Density: | g/cm3 |
Specification: |
FC 650 ,its cas register number is 2409-35-0. It also can be called Alanine, N,N-diethyl-, 2,6-dimethoxyphenyl ester, L-,
hydrochloride ; and L-N,N-Diethylalanine 2,6-dimethoxyphenyl ester hydrochloride .
|
Flash Point: | 154.7°C |
Safety Data |
|
 |