| Identification |
| Name: | 4-Pentynoic acid,2-propyl- |
| CAS: | 24102-11-2 |
| Molecular Formula: | C8H12 O2 |
| Molecular Weight: | 140.1797 |
| InChI: | InChI=1S/C8H12O2/c1-3-5-7(6-4-2)8(9)10/h1,7H,4-6H2,2H3,(H,9,10) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 110.7°C |
| Boiling Point: | 234.8°Cat760mmHg |
| Density: | 1.005g/cm3 |
| Biological Activity: | Orally active valproic acid (Cat No. 2815 ) derivative that exhibits teratogenic and neuroprotective activity. Upregulates neural cell adhesion molecule (NCAM) expression, activates PPAR δ (IC 50 = 0.6 mM) and increases Hoxa1 expression in rat embryos. Antiproliferative; induces G 1 cell cycle arrest in C6 glioma cells (IC 50 ~ 2 mM). |
| Flash Point: | 110.7°C |
| Safety Data |
| |
 |
