| Identification | |
| Name: | 2,3,6-trimethylphenol |
| Synonyms: | Trimethylphenol,95% |
| CAS: | 2416-94-6 |
| EINECS: | 219-330-3 |
| Molecular Formula: | C9H12O |
| Molecular Weight: | 136.19 |
| InChI: | InChI=1/C9H12O/c1-6-4-5-7(2)9(10)8(6)3/h4-5,10H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Density: | 0.996 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.368 (20 C) |
| Water Solubility: | methanol: 0.1 g/mL, clear |
| Solubility: | methanol: 0.1 g/mL, clear |
| Appearance: | White or yellow |
| Specification: |
2,3,6-Trimethylphenol , its CAS NO. is 2416-94-6, the synonyms are 5-26-16-00256 (Beilstein Handbook Reference) ; Adenosine, 2',3'-dideoxy- ; BRN 0619924 ; CCRIS 428 ; D2A ; Dideoxyadenosine ; EINECS 223-853-2 ; NSC 98700 ; ddA ; ddAdo . |
| Packinggroup: | III |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Starting material for vitamin e, co-monomer for the modification of polyphenylene oxide resins. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
