The N-(3-Methylbutyl)-N-methylamine hydrochloride with the CAS number 2419-59-2 is also called N,3-dimethylbutan-1-amine hydrochloride. Its molecular formula is C6H15N.HCl. This chemical should be stored in dry and cool environment.
The properties of the chemical are: (1)ACD/LogP: 1.51; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 1; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 3; (10)Polar Surface Area: 12.03 Å2; (11)Enthalpy of Vaporization: 39.52 kJ/mol; (12)Vapour Pressure: 3.42 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: Cl.CC(C)CCNC
(2)InChI: InChI=1/C6H15N.ClH/c1-6(2)4-5-7-3;/h6-7H,4-5H2,1-3H3;1H
(3)InChIKey: VCJIRVHWQPACGL-UHFFFAOYAY
|