| Identification | |
| Name: | Oxirane,2,2'-[1,4-butanediylbis(oxymethylene)]bis- |
| Synonyms: | Butane,1,4-bis(2,3-epoxypropoxy)- (6CI,8CI);1,4-Bis(2,3-epoxypropoxy)butane;1,4-Bis(2,3-epoxypropyloxy)butane;1,4-Bis(glycidyloxy)butane;1,4-Butanedioldiglycidyl ether;1,4-Butylene glycoldiglycidyl ether;1,4-Diglycidyloxybutane;Tetramethyleneglycol diglycidyl ether;BDDGE;NSC 24834; |
| CAS: | 2425-79-8 |
| EINECS: | 219-371-7 |
| Molecular Formula: | C10H18O4 |
| Molecular Weight: | 202.25 |
| InChI: | InChI=1/C10H18O4/c1(3-11-5-9-7-13-9)2-4-12-6-10-8-14-10/h9-10H,1-8H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.1 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.46-1.465 |
| Water Solubility: | SOLUBLE |
| Solubility: | Soluble in water |
| Appearance: | clear slight yellow to yellow liquid. |
| Storage Temperature: | -20°C |
| Usage: | Reactive diluent for epoxy resins (reduces viscosity). |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
