| Identification | |
| Name: | Ethyl 1-methyl-4-piperidinecarboxylate |
| Synonyms: | Isonipecoticacid, 1-methyl-, ethyl ester (6CI,8CI);1-Methylpiperidine-4-carboxylic acidethyl ester;4-(Ethoxycarbonyl)-1-methylpiperidine;Ethyl 1-methylisonipecotate;EthylN-methylisonipecotate;4-Piperidinecarboxylicacid, 1-methyl-, ethyl ester; |
| CAS: | 24252-37-7 |
| Molecular Formula: | C9H17NO2 |
| Molecular Weight: | 171.24 |
| InChI: | InChI=1/C9H17NO2/c1-3-12-9(11)8-4-6-10(2)7-5-8/h8H,3-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 74.056 °C |
| Boiling Point: | 211.12 °C at 760 mmHg |
| Density: | 0.998 g/cm3 |
| Refractive index: | 1.459 |
| Specification: |
Ethyl 1-methyl-4-piperidinecarboxylate , with CAS number of 24252-37-7, can be called 4-Piperidinecarboxylic acid, 1-methyl-, ethyl ester ; Ethyl 1-Methylpiperidine-4-Carboxylate ; N-Methyl ethyl isonipecotate . |
| Flash Point: | 74.056 °C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
