| Identification | |
| Name: | 3,4,5,6-Tetrahydrophthalic anhydride |
| Synonyms: | Cyclohexene-1,2-dicarboxylic anhydride |
| CAS: | 2426-02-0 |
| EINECS: | 219-374-3 |
| Molecular Formula: | C8H8O3 |
| Molecular Weight: | 152.15 |
| InChI: | InChI=1/C8H8O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 158 C |
| Density: | 1.29 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | REACTS |
| Solubility: | AUTOIGNITION |
| Appearance: | White to Light Yellow Powder |
| Specification: | White to cream crystalline powder Safety Statements:26-36-61-37/39-24-22 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 61:Avoid release to the environment. Refer to special instructions safety data sheet 37/39:Wear suitable protective clothing, gloves and eye/face protection 24:Avoid contact with skin 22:Do not breathe dust |
| Packinggroup: | III |
| Flash Point: | 158 C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
