| Identification | |
| Name: | 2(1H)-Quinoxalinone,6-chloro- |
| Synonyms: | 2-Quinoxalinol,6-chloro- (6CI); 6-Chloro-1,2-dihydroquinoxalin-2-one;6-Chloro-2(1H)-quinoxalinone; 6-Chloro-2-hydroxyquinoxaline;6-Chloro-2-quinoxalinol; 6-Chloroquinoxalin-2-one; 6-Chloroquinoxalone |
| CAS: | 2427-71-6 |
| Molecular Formula: | C8H5 Cl N2 O |
| Molecular Weight: | 180.59 |
| InChI: | InChI=1/C8H5ClN2O/c9-5-1-2-6-7(3-5)10-4-8(12)11-6/h1-4H,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 193.6°C |
| Boiling Point: | 396.5°Cat760mmHg |
| Density: | 1.5g/cm3 |
| Refractive index: | 1.688 |
| Appearance: | Crystalline Powder |
| Specification: |
2-Hydroxy-6-chloroquinoxaline , its CAS NO. is 2427-71-6, the synonyms are 2(1H)-Quinoxalinone, 6-chloro- ; 6-Chloro-2-hydroxyquinoxaline . |
| Flash Point: | 193.6°C |
| Usage: | Intermediate for the production of herbicides. Attributes PIS available, please contact us Contact |
| Safety Data | |
 |
|
