| Identification |
| Name: | 2-Acetylthiazole |
| Synonyms: | 1-(Thiazol-2-yl)ethan-1-one;Methyl 2-thiazolyl ketone;Ethanone, 1-(2-thiazolyl)-;1-(1,3-thiazol-2-yl)ethanone;5-Acetylthiazole;Methyl 5-thiazolyl ketone;FEMA No. 3328;Ketone, methyl 2-thiazolyl;1-(2-Thiazolyl)ethanone;2-Thiazolyl methyl ketone;2-Acetyl-1,3-thiazole;1-(thiazol-2-yl)ethanone; |
| CAS: | 24295-03-2 |
| EINECS: | 246-134-5 |
| Molecular Formula: | C5H5NOS |
| Molecular Weight: | 127.16 |
| InChI: | InChI=1/C5H5NOS/c1-4(7)5-6-2-3-8-5/h2-3H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.22 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.547-1.549 |
| Solubility: | Soluble |
| Appearance: | clear, colorless |
| HS Code: | 29341000 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Stench |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
| |
 |
