Identification |
Name: | 2-Acetylthiazole |
Synonyms: | 1-(Thiazol-2-yl)ethan-1-one;Methyl 2-thiazolyl ketone;Ethanone, 1-(2-thiazolyl)-;1-(1,3-thiazol-2-yl)ethanone;5-Acetylthiazole;Methyl 5-thiazolyl ketone;FEMA No. 3328;Ketone, methyl 2-thiazolyl;1-(2-Thiazolyl)ethanone;2-Thiazolyl methyl ketone;2-Acetyl-1,3-thiazole;1-(thiazol-2-yl)ethanone; |
CAS: | 24295-03-2 |
EINECS: | 246-134-5 |
Molecular Formula: | C5H5NOS |
Molecular Weight: | 127.16 |
InChI: | InChI=1/C5H5NOS/c1-4(7)5-6-2-3-8-5/h2-3H,1H3 |
Molecular Structure: |
 |
Properties |
Density: | 1.22 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.547-1.549 |
Solubility: | Soluble |
Appearance: | clear, colorless |
HS Code: | 29341000 |
Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
Sensitive: | Stench |
Safety Data |
Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
|
 |