| Identification | |
| Name: | Benzeneacetamide,N,N-diethyl- |
| Synonyms: | Acetamide,N,N-diethyl-2-phenyl- (6CI,7CI,8CI); N,N-Diethyl phenylacetamide;N,N-Diethylbenzeneacetamide; NSC 8245; Phenyl-N,N-diethylacetamide |
| CAS: | 2431-96-1 |
| EINECS: | 219-400-3 |
| Molecular Formula: | C12H17 N O |
| Molecular Weight: | 191.272 |
| InChI: | InChI=1/C12H17NO/c1-3-13(4-2)12(14)10-11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 134.3°C |
| Density: | 0.992g/cm3 |
| Refractive index: | n20/D 1.522(lit.) |
| Specification: |
Phenyl-N,N-diethylacetamide ,its cas register number is 2431-96-1. It also can be called Acetamide, N,N-diethyl-2-phenyl- ; Benzeneacetamide, N,N-diethyl- ; and N,N-diethylphenylacetamide . |
| Flash Point: | 134.3°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
