Identification |
Name: | 9-Fluorenemethanol |
Synonyms: | 9H-Fluorene-9-methanol;(Fluoren-9-yl)methanol;9H-fluoren-9-ylmethanol;Fmoc-OH;9-Fluorenemethanol (FMOH);9-Fluorene-methanol;Fluorene-9-methanol; |
CAS: | 24324-17-2 |
EINECS: | 246-167-5 |
Molecular Formula: | C14H12O |
Molecular Weight: | 196.24 |
InChI: | InChI=1/C14H12O/c15-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14-15H,9H2 |
Molecular Structure: |
 |
Properties |
Boiling Point: | 337 |
Density: | 1.175g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.638 |
Solubility: | Insoluble |
Appearance: | White to pale yellow solid. |
Packinggroup: | I; II; III |
HS Code: | 29062900 |
Safety Data |
|
 |