| Identification | |
| Name: | 6-Amino-1-methyluracil |
| Synonyms: | 6-Amino-1-methyl-1H-pyrimidine-2,4-dione;2,4(1H,3H)-Pyrimidinedione,6-amino-1-methyl-;Uracil,6-amino-1-methyl- (7CI,8CI);1-Methyl-6-aminouracil; |
| CAS: | 2434-53-9 |
| EINECS: | 219-422-3 |
| Molecular Formula: | C5 H7 N3 O2 |
| Molecular Weight: | 141.13 |
| InChI: | InChI=1/C5H7N3O2/c1-8-3(6)2-4(9)7-5(8)10/h2H,6H2,1H3,(H,7,9,10) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.339 g/cm3 |
| Refractive index: | 1.548 |
| Appearance: | almost white to slightly beige crystalline powder |
| Specification: |
6-Amino-1-methyluracil (CAS NO.2434-53-9), it can be called 6-Amino-1-methylpyrimidine-2,4(1H,3H)-dione ; 2,4(1H,3H)-Pyrimidinedione,6-amino-1-methyl- and 1-Methyl-6-aminouracil . It is almost white to slightly beige crystalline powder. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
