Specification: |
The CAS register number of 2,5-Anhydro-1-azido-1-deoxy-D-glucitol is 243469-59-2. The systematic name about this chemical is D-glucitol, 2,5-anhydro-1-azido-1-deoxy-. The molecular formula about this chemical is C6H11N3O4 and the molecular weight is 189.17. It belongs to the Sugars.
Physical properties about 2,5-Anhydro-1-azido-1-deoxy-D-glucitol are: (1)ACD/BCF (pH 5.5): 1; (2)ACD/BCF (pH 7.4): 1; (3)ACD/KOC (pH 5.5): 13.84; (4)ACD/KOC (pH 7.4): 13.84; (5)#H bond acceptors: 7; (6)#H bond donors: 3; (7)#Freely Rotating Bonds: 6; (8)Polar Surface Area: 82.28Å2.
You can still convert the following datas into molecular structure:
(1)SMILES: C([C@H]1[C@H]([C@@H]([C@H](O1)CO)O)O)N=[N+]=[N-]
(2)InChI: InChI=1/C6H11N3O4/c7-9-8-1-3-5(11)6(12)4(2-10)13-3/h3-6,10-12H,1-2H2/t3-,4+,5+,6+/m0/s1
(3)InChIKey: SXQJFSPBUVMKMT-SLPGGIOYBV
(4)Std. InChI: InChI=1S/C6H11N3O4/c7-9-8-1-3-5(11)6(12)4(2-10)13-3/h3-6,10-12H,1-2H2/t3-,4+,5+,6+/m0/s1
(5)Std. InChIKey: SXQJFSPBUVMKMT-SLPGGIOYSA-N
|