| Identification | |
| Name: | Benzeneacetonitrile,2,3,4-trifluoro- |
| Synonyms: | 2,3,4-Trifluorophenylacetonitrile |
| CAS: | 243666-13-9 |
| Molecular Formula: | C8H4 F3 N |
| Molecular Weight: | 171.12 |
| InChI: | InChI=1/C8H4F3N/c9-6-2-1-5(3-4-12)7(10)8(6)11/h1-2H,3H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Flash Point: | 85.2°C |
| Boiling Point: | 217.2°Cat760mmHg |
| Density: | 1.334g/cm3 |
| Refractive index: | 1.468 |
| Specification: |
2,3,5,6-Tetrafluoro-1,4-benzenedimethanol , its cas register number is 243666-13-9. It also can be called 2,3,4-Trifluorobenzyl cyanide ; and Benzeneacetonitrile, 2,3,4-trifluoro- . |
| Flash Point: | 85.2°C |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
