| Identification |
| Name: | 7H-Pyrrolo[2,3-d]pyrimidin-4-amine,5-iodo-7-b-D-ribofuranosyl- |
| Synonyms: | 7H-Pyrrolo[2,3-d]pyrimidine,4-amino-5-iodo-7-b-D-ribofuranosyl-(8CI);4-Amino-5-iodo-7-b-D-ribofuranosyl-7H-pyrrolo[2,3-d]pyrimidine;4-Amino-5-iodo-7-b-D-ribofuranosylpyrrolo[2,3-d]pyrimidine;5-Iodotubercidin;7-Iodotubercidin;NSC 113939; |
| CAS: | 24386-93-4 |
| Molecular Formula: | C11H13IN4O4 |
| Molecular Weight: | 392.14979 |
| InChI: | InChI=1S/C11H13IN4O4/c12-4-1-16(10-6(4)9(13)14-3-15-10)11-8(19)7(18)5(2-17)20-11/h1,3,5,7-8,11,17-19H,2H2,(H2,13,14,15) |
| Molecular Structure: |
![(C11H13IN4O4) 7H-Pyrrolo[2,3-d]pyrimidine,4-amino-5-iodo-7-b-D-ribofuranosyl-(8CI);4-Amino-5-iodo-7-b-D-ribofurano...](https://img1.guidechem.com/chem/e/dict/23/24386-93-4.jpg) |
| Properties |
| Density: | 2.49 g/cm3 |
| Refractive index: | 1.918 |
| Water Solubility: | 0.1 M HCl: 0.7 mg/mL |
| Solubility: | 0.1 M HCl: 0.7 mg/mL |
| Appearance: | Tan Solid |
| Biological Activity: | Potent adenosine kinase inhibitor (IC 50 = 26 nM) and nucleoside transporter inhibitor (IC 50 values are 7, 15 and < 25 nM for inhibition of [ 3 H]-uridine, [ 3 H]-formycin B and [ 3 H]-adenosine uptake respectively). Strongly stimulates glycogen synthesis in hepatocytes via activation of glycogen synthase. Also inhibits CK1, insulin receptor tyrosine kinase, phosphorylase kinase, PKA, CK2 and PKC (IC 50 values are 0.4, 3.5, 5-10, 5-10, 10.9 and 27.7 μ M respectively). |
| Storage Temperature: | 2-8°C |
| Color: | tan |
| Usage: | An analogue of the antibiotic tubercidin, a pyrrolo[2,3-d]pyrimidine nucleoside antibiotic. A potent inhibitor of adenosine kinase from rat or guinea pig brain. Inhibits uptake of 3H-adenosine into brain slices. |
| Safety Data |
| |
 |
