| Identification |
| Name: | N,N-Dimethylaminoethyl acrylate |
| Synonyms: | 2-(Dimethylamino)ethyl acrylate; Acrylic acid 2-(dimethylamino)ethyl ester; DMAEA; ADAME; DA; DAA |
| CAS: | 2439-35-2 |
| EINECS: | 219-460-0 |
| Molecular Formula: | C7H13NO2 |
| Molecular Weight: | 143.18 |
| InChI: | InChI=1/C7H13NO2/c1-4-7(9)10-6-5-8(2)3/h4H,1,5-6H2,2-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3302 |
| Melting Point: | -60°C |
| Density: | 0.943 |
| Stability: | No data. |
| Refractive index: | 1.438 |
| Water Solubility: | Soluble in water and other ordinary organic solvent |
| Solubility: | Soluble in water and other ordinary organic solvent |
| Appearance: | almost colourless liquid |
| Packinggroup: | II |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data |
| Hazard Symbols |
T+:Verytoxic
|
| |
 |
