| Identification |
| Name: | Dibenziodolium |
| Synonyms: | 2,2'-Biphenylyleneiodonium;Diphenyleneiodonium; [1,1'-Biphenyl]-2,2'-diyliodonium |
| CAS: | 244-54-2 |
| Molecular Formula: | C12H8 I |
| Molecular Weight: | 314.55 |
| InChI: | InChI=1S/C12H8I/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H/q+1 |
| Molecular Structure: |
![(C12H8I) 2,2'-Biphenylyleneiodonium;Diphenyleneiodonium; [1,1'-Biphenyl]-2,2'-diyliodonium](https://img1.guidechem.com/chem/e/dict/98/244-54-2.jpg) |
| Properties |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Biological Activity: | Binds strongly to flavoproteins and is thus a potent inhibitor of several important enzymes, including NO synthase, NADH reductase and oxidase. Inhibits platelet aggregation. |
| Flash Point: | °C |
| Safety Data |
| |
 |
