| Identification | |
| Name: | 5-Aminoindan |
| Synonyms: | Aminoindan; 96%; 5-Indanamine |
| CAS: | 24425-40-9 |
| EINECS: | 246-241-7 |
| Molecular Formula: | C9H11N |
| Molecular Weight: | 133.19 |
| InChI: | InChI=1/C9H11N/c10-9-5-4-7-2-1-3-8(7)6-9/h4-6H,1-3,10H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1.102 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.624 |
| Water Solubility: | SLIGHTLY SOLUBLE |
| Solubility: | slightly soluble AUTOIGNITION |
| Appearance: | clear to light yellow semi-solid |
| Specification: |
?5-Aminoindan ; 5-aminoindane ; 5-aminohydrindene ; 5-indanamine ; akos 91137 ; labotest-bb lt00080766;1h-inden-5-amine, 2,3-dihydro- ; 2,3-dihydro-1h-inden-5-ylamine .It is a?brown crystalline mass. |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
