| Identification | |
| Name: | 9H-Fluoren-2-ol |
| Synonyms: | Fluoren-2-ol(6CI,7CI,8CI); 2-Hydroxy-9H-fluorene; 2-Hydroxyfluorene; NSC 26316; NSC 31248 |
| CAS: | 2443-58-5 |
| EINECS: | 219-478-9 |
| Molecular Formula: | C13H10 O |
| Molecular Weight: | 182.22 |
| InChI: | InChI=1/C13H10O/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8,14H,7H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 167-169 °C(lit.) |
| Flash Point: | 182°C |
| Boiling Point: | 372.1°Cat760mmHg |
| Density: | 1.241g/cm3 |
| Refractive index: | 1.683 |
| Specification: | White Solid usageEng:A metabolite of polycyclic aromatic hydrocarbons in humans. Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 182°C |
| Storage Temperature: | Refrigerator |
| Usage: | A metabolite of polycyclic aromatic hydrocarbons in humans. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
