| Identification | |
| Name: | Benzeneaceticacid, 2-chloro- |
| Synonyms: | Aceticacid, (o-chlorophenyl)- (7CI,8CI);(2-Chlorophenyl)acetic acid;(o-Chlorophenyl)acetic acid;2-(o-Chlorophenyl)ethanoic acid;NSC 4613;O-chlorophenylacetic acid; |
| CAS: | 2444-36-2 |
| EINECS: | 219-482-0 |
| Molecular Formula: | C8H7ClO2 |
| Molecular Weight: | 170.59 |
| InChI: | InChI=1/C8H7ClO2/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4H,5H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 131.7 oC |
| Boiling Point: | 294.1 oC at 760 mmHg |
| Density: | 1.324 g/cm3 |
| Appearance: | White to light yellow powder |
| Specification: |
?2-Chlorophenylacetic acid (CAS NO.2444-36-2)?is also named as?(2-Chlorophenyl)acetic acid ; (o-Chlorophenyl)acetic acid ; Acetic acid, (o-chlorophenyl)- (8CI) ; Benzeneacetic acid, 2-chloro- (9CI) .?It is white to light yellow powder. |
| Flash Point: | 131.7 oC |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
