Identification |
Name: | Nonivamide |
Synonyms: | pelargonic acid vanillylamide; N-Vanillylnonanamide (Synthetic Capsaicin) = N-[94-hydroxy-3-methoxyphenyl)methyl]nonanamide; Capsaicinsynthesispelargonylvanillylamide); 95%; Capsaicin (synthesis)(=n-Pelargonylvanillylamide); Nonylic Acid Vanillylamide (Nonivamide); nonivamide capsaicine; |
CAS: | 2444-46-4 |
EINECS: | 219-484-1 |
Molecular Formula: | C17H27NO3 |
Molecular Weight: | 293.4 |
InChI: | InChI=1/C17H27NO3/c1-3-4-5-6-7-8-9-17(20)18-13-14-10-11-15(19)16(12-14)21-2/h10-12,19H,3-9,13H2,1-2H3,(H,18,20) |
Molecular Structure: |
 |
Properties |
Transport: | UN 2811 |
Density: | 1.037 g/cm3 |
Stability: | Stable. Incompatible with strong oxidizing agents. |
Refractive index: | 1.513 |
Solubility: | methanol: 100 mg/mL, clear to slightly hazy |
Appearance: | white to brown powder |
Color: | white to off-white |
Safety Data |
Hazard Symbols |
T:Toxic
|
|
 |