| Identification | |
| Name: | Carbamodithioic acid,N,N-dimethyl-, C,C'-bis(anhydrosulfide) with As-methylarsonodithious acid |
| Synonyms: | Carbamicacid, dimethyldithio-, bis(anhydrosulfide) with dithiomethanearsonous acid(6CI,7CI,8CI); Carbamodithioic acid, dimethyl-, bis(anhydrosulfide) withmethylarsonodithious acid (9CI); Bis(dimethylthiocarbamylthio)methyl arsine;Methyl arsine-bis(dimethyldithiocarbamate);Methylbis(dimethylthiocarbamoylthio)arsine; Urbacid |
| CAS: | 2445-07-0 |
| Molecular Formula: | C7H15 As N2 S4 |
| Molecular Weight: | 330.389 |
| InChI: | InChI=1/C7H15AsN2S4/c1-8(13-6(11)9(2)3)14-7(12)10(4)5/h1-5H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 61878 |
| Melting Point: | 144 |
| Boiling Point: | 357.1°C at 760 mmHg |
| Specification: |
Urbacid ,its cas register number is 2445-07-0. It also can be called Methylarsenic dimethyl dithiocarbamate ; and Urbazid . |
| Report: |
Arsenic and its compounds are on the Community Right-To-Know List. |
| Safety Data | |
 |
|
