| Identification | |
| Name: | 5H-1,4-Dithiino[2,3-c]pyrrole-5,7(6H)-dione,2,3-dihydro- |
| Synonyms: | p-Dithiin-2,3-dicarboximide,5,6-dihydro- (6CI,8CI); 3,6-Dithia-3,4,5,5-tetrahydrophthalimide; 5,6-Dihydro-1,4-dithiin-2,3-dicarboximide;NSC 179792 |
| CAS: | 24519-85-5 |
| Molecular Formula: | C6H5 N O2 S2 |
| Molecular Weight: | 187.24 |
| InChI: | InChI=1/C6H5NO2S2/c8-5-3-4(6(9)7-5)11-2-1-10-3/h1-2H2,(H,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 217°C |
| Flash Point: | 172.5°C |
| Boiling Point: | 361.5°Cat760mmHg |
| Density: | 1.64g/cm3 |
| Refractive index: | 1.722 |
| Specification: |
5,6-Dihydro-p-dithiin-2,3-dicarboximide , its cas register number is 24519-85-5. It also can be called 3,6-Dithia-3,4,5,5-tetrahydrophthalimide ; BRN 0516952 ; NSC 179792 ; 5,6-Dihydro-4-dithiin-2,3-dicarboxylic acid imide . You should avoid contact 5,6-Dihydro-p-dithiin-2,3-dicarboximide (CAS NO.24519-85-5) with skin and eyes and not breathe dust. |
| Flash Point: | 172.5°C |
| Safety Data | |
 |
|
