| Identification | |
| Name: | Pyridine,3,5-dichloro- |
| Synonyms: | NSC 60546; |
| CAS: | 2457-47-8 |
| EINECS: | 219-537-9 |
| Molecular Formula: | C5H3Cl2N |
| Molecular Weight: | 147.99 |
| InChI: | InChI=1/C5H3Cl2N/c6-4-1-5(7)3-8-2-4/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.388 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.777 |
| Solubility: | Insoluble |
| Appearance: | white crystalline powder |
| Specification: |
Removal in wastewater treatment of 3,5-Dichloropyridine (2457-47-8) can be stated as follows: |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
