| Identification |
| Name: | 4-Amino-2-chlorobenzoic acid |
| Synonyms: | 4-amino-2-chloro-benzoate;4-14-00-01272 (Beilstein Handbook Reference);USAF NB-1;Benzoic acid, 4-amino-2-chloro-;o-Chloro-p-aminobenzoic acid;2-Chloro-p-aminobenzoic acid;4-Amino-3-trifluoromethyl benzoic acid; |
| CAS: | 2457-76-3 |
| EINECS: | 219-540-5 |
| Molecular Formula: | C7H6ClNO2 |
| Molecular Weight: | 171.58 |
| InChI: | InChI=1/C7H6ClNO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,9H2,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 174.8 °C |
| Boiling Point: | 365.3 °Cat760mmHg |
| Density: | 1.476 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | beige to light brown powder |
| HS Code: | 29224995 |
| Flash Point: | 174.8 °C |
| Storage Temperature: | −20°C |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
