| Identification | |
| Name: | Mercury,chloro(2-hydroxy-3,5-dinitrophenyl)- |
| Synonyms: | Phenol,2,4-dinitro-, mercury complex; 2-Chloromercuri-4,6-dinitrophenol |
| CAS: | 24579-91-7 |
| Molecular Formula: | C6H3 Cl Hg N2 O5 |
| Molecular Weight: | 419.15 |
| InChI: | InChI=1/C6H3N2O5.ClH.Hg/c9-6-2-1-4(7(10)11)3-5(6)8(12)13;;/h1,3,9H;1H;/q;;+1/p-1/rC6H3ClHgN2O5/c7-8-4-1-3(9(12)13)2-5(6(4)11)10(14)15/h1-2,11H |
| Molecular Structure: |  |
| Properties | |
| Specification: |
Chloro(2-hydroxy-3,5-dinitrophenyl) Mercury , its cas register number is 24579-91-7. It also can be called Phenol, 2-(chloromercuri)-4,6-dinitro- ; and 2-Chloromercuri-4,6-dinitrophenol . Its classification code are Agricultural Chemical; Experimental pesticide; Organometallic andUnspecified / Unclassified pesticide. |
| Report: |
Mercury and its compounds are on the Community Right-To-Know List. |
| Safety Data | |
 |
|
