| Identification | |
| Name: | 3-Amino-4-methylbenzoic acid |
| Synonyms: | 3-amino-4-methyl-benzoate;3-Amino-p-toluic acid;4-Methyl-3-aminobenzoic acid; |
| CAS: | 2458-12-0 |
| EINECS: | 219-543-1 |
| Molecular Formula: | C8H9NO2 |
| Molecular Weight: | 151.16 |
| InChI: | InChI=1/C8H9NO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4H,9H2,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.254 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | very soluble in water |
| Solubility: | very soluble in water |
| Appearance: | Sallow pink chunks-powder. |
| Specification: |
3-Amino-4-methylbenzoic acid , its CAS NO. is 2458-12-0, the synonym is 3-Amino-p-toluic acid . |
| HS Code: | 29224995 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
