| Identification |
| Name: | 2-Ethylhexyl glycidyl ether |
| Synonyms: | Oxirane,[[(2-ethylhexyl)oxy]methyl]- (9CI);Propane, 1,2-epoxy-3-[(2-ethylhexyl)oxy]-(6CI,7CI,8CI);1-(2-Ethylhexyloxy)-2,3-epoxypropane;Oxirane,2-[[(2-ethylhexyl)oxy]methyl]-;Adeka Glycilol ED 518;Adeka Glycilol ED 518S;Denacol EX 12;Denacol EX121;ED 518;Epiol EH;Epodil 746;Epodil 747;Glycidyl 2-ethylhexyl ether;Grilonit 1807-41;Heloxy 116;Heloxy MK 116;JX 014;Laproxid 301;NSC 252154;[[(2-Ethylhexyl)oxy]methyl]oxirane; |
| CAS: | 2461-15-6 |
| EINECS: | 219-553-6 |
| Molecular Formula: | C11H22O2 |
| Molecular Weight: | 186.33 |
| InChI: | InChI=1/C11H22O2/c1-3-5-6-10(4-2)7-12-8-11-9-13-11/h10-11H,3-9H2,1-2H3 |
| Molecular Structure: |
![(C11H22O2) Oxirane,[[(2-ethylhexyl)oxy]methyl]- (9CI);Propane, 1,2-epoxy-3-[(2-ethylhexyl)oxy]-(6CI,7CI,8CI);1-...](https://img1.guidechem.com/chem/e/dict/165/2461-15-6.jpg) |
| Properties |
| Flash Point: | 206 ºF |
| Density: | 0.891 |
| Stability: | Stable. Combustible. Incompatible with strong oxidising agents, acids, bases. |
| Refractive index: | 1.434 |
| Water Solubility: | | <0.1 g/100 mL at 19 ºC |
| Solubility: | <0.1 g/100 mL at 19 ºC in water |
| Appearance: | colourless liquid |
| Flash Point: | 206 ºF |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
