| Identification |
| Name: | 9-Octadecenoic acid,methyl ester |
| Synonyms: | Methyl9-octadecenoate |
| CAS: | 2462-84-2 |
| EINECS: | 219-559-9 |
| Molecular Formula: | C19H36 O2 |
| Molecular Weight: | 296.4879 |
| InChI: | InChI=1/C19H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h10-11H,3-9,12-18H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 92.4°C |
| Boiling Point: | 351.4°Cat760mmHg |
| Density: | 0.873g/cm3 |
| Solubility: | Insol in water; miscible with ethyl alcohol, ether; sol in chloroform |
| Flash Point: | 92.4°C |
| Color: | Colorless to amber clear liquid |
| Safety Data |
| |
 |
