| Identification | |
| Name: | 1,3-Dioxolan-2-one,4-(chloromethyl)- |
| Synonyms: | Carbonicacid, (chloromethyl)ethylene ester (6CI); Carbonic acid, cyclic(chloromethyl)ethylene ester (7CI,8CI); 1,2-Propanediol, 3-chloro-, cycliccarbonate (8CI); (Chloromethyl)ethylene carbonate; 3-Chloro-1,2-propylenecarbonate; 4-(Chloromethyl)-1,3-dioxolan-2-one;4-Chloromethyl-1,3-dioxol-2-one; 4-Chloromethyl-2-oxo-1,3-dioxolane;Chloropropylene carbonate; Cyclic (chloromethyl)ethylene carbonate;Epichlorohydrin carbonate; NSC 76035 |
| CAS: | 2463-45-8 |
| Molecular Formula: | C4H5 Cl O3 |
| Molecular Weight: | 136.54 |
| InChI: | InChI=1/C4H5ClO3/c5-1-3-2-7-4(6)8-3/h3H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 148.6°C |
| Boiling Point: | 290.1°Cat760mmHg |
| Density: | 1.39g/cm3 |
| Refractive index: | 1.448 |
| Specification: |
Carbonic acid, cyclic 3-chloropropylene ester with cas registry number of 2463-45-8 is also known as 1,3-Dioxolan-2-one, 4-(chloromethyl)- ; 4-(Chloromethyl)-1,3-dioxolan-2-one ; 5-19-04-00023 (Beilstein Handbook Reference) ; Carbonic acid, (chloromethyl)ethylene ester (6CI) ; Carbonic acid, cyclic (chloromethyl)ethylene ester (7CI,8CI) ; Epichlorohydrin carbonate ; NSC 76035 . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 148.6°C |
| Safety Data | |
 |
|
