| Identification | |
| Name: | 2,3-Pyridinediamine,5-methyl- |
| Synonyms: | 3-Picoline,5,6-diamino- (8CI); 2,3-Diamino-5-methylpyridine |
| CAS: | 24638-29-7 |
| Molecular Formula: | C6H9 N3 |
| Molecular Weight: | 123.16 |
| InChI: | InChI=1/C6H9N3/c1-4-2-5(7)6(8)9-3-4/h2-3H,7H2,1H3,(H2,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.19 g/cm3 |
| Refractive index: | 1.648 |
| Specification: |
The 2,3-Diamino-5-methylpyridine, with the CAS registry number 24638-29-7, has the systematic name of 5-methylpyridine-2,3-diamine. It is also called 2,3-pyridinediamine, 5-methyl-, and should be stored at dry and cool environment. And the molecular formula of the chemical is C6H9N3. The characteristics of 2,3-Diamino-5-methylpyridine are as followings: (1)ACD/LogP: 0.07; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0; (4)ACD/LogD (pH 7.4): 1; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 2; (7)ACD/KOC (pH 5.5): 8; (8)ACD/KOC (pH 7.4): 55; (9)#H bond acceptors: 3; (10)#H bond donors: 4; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 64.93 Å2; (13)Index of Refraction: 1.648; (14)Molar Refractivity: 37.641 cm3; (15)Molar Volume: 103.493 cm3; (16)Polarizability: 14.922×10-24cm3; (17)Surface Tension: 62.279 dyne/cm; (18)Density: 1.19 g/cm3; (19)Flash Point: 170.583 °C; (20)Enthalpy of Vaporization: 55.703 kJ/mol; (21)Boiling Point: 315.761 °C at 760 mmHg; (22)Vapour Pressure: 0 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
