| Identification | |
| Name: | 2-Propanone, 1-mercapto- |
| Synonyms: | 2-Propanone,mercapto- (6CI,7CI);1-Mercapto-2-propanone;3-Mercapto-2-propanone;Mercaptoacetone;2-Propanone,1-mercapto- (8CI,9CI); |
| CAS: | 24653-75-6 |
| Molecular Formula: | C3H6OS |
| Molecular Weight: | 90.1441 |
| InChI: | InChI=1/C3H6OS/c1-3(4)2-5/h5H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 34.6 ºC |
| Boiling Point: | 133.6 ºC at 760 mmHg |
| Density: | 1.01 g/cm3 |
| Refractive index: | 1.447 |
| Water Solubility: | soluble in oil and alcohol |
| Solubility: | soluble in oil and alcohol |
| Appearance: | colourless to pale yellow liquid |
| Specification: |
2-Propanone, 1-mercapto- (CAS NO.24653-75-6), its Synonyms are 1-Mercapto-2-propanone ; 2-Propanone,mercapto- (6CI,7CI) ; 1-Mercapto-2-propanone ; 3-Mercapto-2-propanone ; Mercaptoacetone ; 2-Propanone,1-mercapto- (8CI,9CI) . |
| Flash Point: | 34.6 ºC |
| Safety Data | |
 |
|
