| Identification |
| Name: | Ethanone,1-(1H-imidazol-1-yl)- |
| Synonyms: | 1H-Imidazole,1-acetyl- (9CI);Imidazole, 1-acetyl- (6CI,8CI);1-Acetyl-1H-imidazole;Acetylimidazole;N-Acetylimidazole; |
| CAS: | 2466-76-4 |
| EINECS: | 219-577-7 |
| Molecular Formula: | C5H6N2O |
| Molecular Weight: | 110.11 |
| InChI: | InChI=1/C5H6N2O/c1-5(8)7-3-2-6-4-7/h2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs
|
| Density: | 1.14 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.552 |
| Appearance: | white
to yellowish crystals |
| Storage Temperature: | Store at 0 |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
|
| |
 |
