| Identification | |
| Name: | Thiocyanic acid,1-chloro-1,2-ethanediyl ester (9CI) |
| Synonyms: | Thiocyanicacid, chloroethylene ester (8CI); 1-Chloro-1,2-ethanediyl bisthiocyanate;Chloroethylene bisthiocyanate |
| CAS: | 24689-89-2 |
| Molecular Formula: | C4H3 Cl N2 S2 |
| Molecular Weight: | 178.66 |
| InChI: | InChI=1/C4H3ClN2S2/c5-4(9-3-7)1-8-2-6/h4H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 147.2°C |
| Boiling Point: | 319.7°Cat760mmHg |
| Density: | 1.476g/cm3 |
| Refractive index: | 1.596 |
| Specification: |
Chloroethylene bisthiocyanate , its cas register number is 24689-89-2. It also can be called Thiocyanic acid, 1-chloro-1,2-ethanediyl ester ; and Thiocyanic acid, chloroethylene ester . |
| Flash Point: | 147.2°C |
| Safety Data | |
 |
|
