| Identification | |
| Name: | 2(1H)-Naphthalenone,3,4-dihydro-6-methoxy- |
| Synonyms: | 3,4-Dihydro-6-methoxynaphthalen-2(1H)-one;6-Methoxy-3,4-dihydro-1H-naphthalen-2-one;6-Methoxy-3,4-dihydro-2(1H)-naphthalenone;6-Methoxy-b-tetralone; |
| CAS: | 2472-22-2 |
| EINECS: | 219-592-9 |
| Molecular Formula: | C11H12O2 |
| Molecular Weight: | 176.2118 |
| InChI: | InChI=1S/C11H12O2/c1-13-11-5-3-8-6-10(12)4-2-9(8)7-11/h3,5,7H,2,4,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 28-35 ºC |
| Flash Point: | >110 ºC |
| Density: | 1.124 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5645 |
| Appearance: | White Crystal |
| Specification: | light yellow-beige to orange Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Flash Point: | >110 ºC |
| Storage Temperature: | 0-6°C |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
