| Identification |
| Name: | Butanamide,N,N'-1,4-phenylenebis[3-oxo- |
| Synonyms: | Acetoacetamide,N,N'-p-phenylenebis- (6CI);1,4-Bis(acetoacetamido)benzene;1,4-Bis(acetoacetylamino)benzene;NSC 87597; |
| CAS: | 24731-73-5 |
| EINECS: | 246-438-8 |
| Molecular Formula: | C14H16N2O4 |
| Molecular Weight: | 276.29 |
| InChI: | InChI=1/C14H16N2O4/c1-9(17)7-13(19)15-11-3-5-12(6-4-11)16-14(20)8-10(2)18/h3-6H,7-8H2,1-2H3,(H,15,19)(H,16,20) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 234.4 ºC |
| Boiling Point: | 582.2 ºC at 760 mmHg |
| Density: | 1.279 g/cm3 |
| Refractive index: | 1.595 |
| Appearance: | White to grey-brown powder |
| Flash Point: | 234.4 ºC |
| Usage: | Diacetoacet-1,4-phenylenediamide (DiAAphendiam) is used as intermediate for the manufacture of organic pigments. Product Data Sheet |
| Safety Data |
| |
 |
