| Identification | |
| Name: | 9,10-Anthracenedione,1,4-bis(methylamino)- |
| Synonyms: | Anthraquinone,1,4-bis(methylamino)- (6CI,7CI,8CI);1,4-Bis(methylamino)-9,10-anthraquinone;1,4-Bis(methylamino)anthraquinone;1,4-Bis-N-methylamino-9,10-anthraquinone;Acetate Blue B;Artisil Blue BRP;C.I. 61500;C.I. Disperse Blue 110;C.I.Disperse Blue 14;C.I. Disperse Blue 78;C.I. Solvent Blue 78;C.I. SolventBlue 93;Celliton Fast Blue B;Cibacet Blue BR;Cilla Fast Blue B;DiaresinBlue K;Disperse Blue 110;Disperse Blue 78;DuranolBrilliant Blue G;Intratherm Blue P 1404;Macrolex Blue FR;NSC 86161;PlastBlue 8516;Resiren Blue TB;Serisol Brilliant Blue G;Setacyl Blue BS;SolventBlue 78;Solvent Blue 93;Sumiplast Blue GP;Supracet Fast Blue 2G; |
| CAS: | 2475-44-7 |
| EINECS: | 219-602-1 |
| Molecular Formula: | C16H14N2O2 |
| Molecular Weight: | 266.3 |
| InChI: | InChI=1/C16H14N2O2/c1-17-11-7-8-12(18-2)14-13(11)15(19)9-5-3-4-6-10(9)16(14)20/h3-8,17-18H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 214°C |
| Boiling Point: | 528°Cat760mmHg |
| Density: | 1.345g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.716 |
| Appearance: | A dense liquid with a pleasant aromatic odor. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 214°C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
