Identification |
Name: | Benzoic acid,2-[(9H-fluoren-2-ylamino)carbonyl]- |
Synonyms: | Phthalamicacid, N-fluoren-2-yl- (6CI,7CI,8CI); N-2-Fluorenylphthalamic acid |
CAS: | 2485-10-1 |
Molecular Formula: | C21H15 N O3 |
Molecular Weight: | 329.37 |
InChI: | InChI=1/C21H15NO3/c23-20(18-7-3-4-8-19(18)21(24)25)22-15-9-10-17-14(12-15)11-13-5-1-2-6-16(13)17/h1-10,12H,11H2,(H,22,23)(H,24,25) |
Molecular Structure: |
|
Properties |
Flash Point: | 255.5°C |
Boiling Point: | 498.9°Cat760mmHg |
Density: | 1.373g/cm3 |
Refractive index: | 1.726 |
Specification: |
N-Fluorenyl-2-phthalimic acid , its cas register number is 2485-10-1. It also can be called Phthalamic acid, N-fluoren-2-yl- ; N-Fluorenyl-2-phthalimic acid ; and 2-Benzoylamidofluorene-2'-carboxylate .
|
Flash Point: | 255.5°C |
Safety Data |
|
|