| Identification | |
| Name: | Methyl dihydrojasmonate |
| Synonyms: | Cyclopentaneaceticacid, 3-oxo-2-pentyl-, methyl ester;Kharismal;Methyl (2-pentyl-3-oxocyclopentyl)acetate;Methyl(3-oxo-2-pentylcyclopentyl)acetate;methyl dihydrojasmonate (MDJ);Hedione; |
| CAS: | 24851-98-7 |
| EINECS: | 246-495-9 |
| Molecular Formula: | C13H22O3 |
| Molecular Weight: | 226.31 |
| InChI: | InChI=1S/C13H22O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h10-11H,3-9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Refractive index: | 1.459 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | pale straw yellow to yellow transparent oily liquid |
| Specification: |
Hedione (CAS NO.24851-98-7) is also named as Cyclopentaneacetic acid, 3-oxo-2-pentyl-, methyl ester ; FEMA No. 3408 ; Kharismal ; Methyl (2-pentyl-3-oxocyclopentyl)acetate ; Methyl (3-oxo-2-pentylcyclopentyl)acetate ; Methyl 3-oxo-2-pentyl-cyclopentaneacetate ; Methyl 3-oxo-2-pentylcyclopentaneacetate ; Methyl dihydrojasmonate . Hedione (CAS NO.24851-98-7) is pale straw yellow to yellow transparent oily liquid. It is an ester and a diffusive aroma compound, with the smell vaguely similar to jasmine. |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
