| Identification | |
| Name: | Trimethoxysilane |
| Synonyms: | TrimethoxysilanecontainsSiClforstability |
| CAS: | 2487-90-3 |
| EINECS: | 219-637-2 |
| Molecular Formula: | C3H10O3Si |
| Molecular Weight: | 122.2 |
| InChI: | InChI=1/C3H10O3Si/c1-4-7(5-2)6-3/h7H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3384/9269 |
| Flash Point: | 24? |
| Density: | 0.96 |
| Stability: | May decompose upon exposure to air or water. Incompatible with strong oxidizing agents, strong bases, strong acids. |
| Refractive index: | 1.358 |
| Solubility: | |
| Appearance: | colorless transparent liquid |
| Packinggroup: | I |
| Flash Point: | 24? |
| Storage Temperature: | Flammables area |
| Color: | Liquid |
| Usage: | Used to prepare a number of organic coupling agents utilized by the plastics industry as adhesion promotors. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
T+:Verytoxic
|
 |
|
