| Identification | |
| Name: | Urea,N-(4-arsenosophenyl)- |
| Synonyms: | Urea,(4-arsenosophenyl)- (9CI); Urea, (p-arsenosophenyl)- (6CI,7CI,8CI); NSC 12693 |
| CAS: | 2490-89-3 |
| Molecular Formula: | C7H7 As N2 O2 |
| Molecular Weight: | 226.08 |
| InChI: | InChI=1/C7H7AsN2O2/c9-7(11)10-6-3-1-5(8-12)2-4-6/h1-4H,(H3,9,10,11) |
| Molecular Structure: |  |
| Properties | |
| Specification: |
Carbarsone oxide , its CAS NO. is 2490-89-3, the synonyms are 1-(p-Arsenophenyl)urea ; 1-(p-Arsenosophenyl)urea ; Arsine, 4-carbamidophenyloxo- ; Chemotherapy center No. 606 ; NSC 12693 ; Urea, 1-(p-arsenosophenyl) ; p-Carbamidophenyl arsenous acid ; p-Carbamidophenyl arsenous oxide ; Urea, (p-arsenosophenyl)- (8CI) . |
| Report: |
Arsenic and its compounds are on the Community Right-To-Know List. |
| Safety Data | |
 |
|
