Identification |
Name: | Ethanone,2-bromo-1-(4-hydroxyphenyl)- |
Synonyms: | 4'-Hydroxy-2-bromoacetophenone;Busan 1130;4-Hydroxyphenacyl bromide;Busan 90;Butrol 1130;p-Hydroxyphenacyl bromide;a-Bromo-4'-hydroxyacetophenone;2-Bromo-1-(4-hydroxyphenyl)ethan-1-one;1-(4-Hydroxyphenyl)-2-bromoethanone;w-Bromo-p-hydroxyacetophenone; |
CAS: | 2491-38-5 |
EINECS: | 219-655-0 |
Molecular Formula: | C8H7BrO2 |
Molecular Weight: | 215.05 |
InChI: | InChI=1S/C8H7BrO2/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4,10H,5H2 |
Molecular Structure: |
 |
Properties |
Transport: | 1760 |
Density: | 1.622 g/cm3 |
Appearance: | clear colorless to light yellow liquid |
Specification: | Pale Beige Solid usageEng:A covalent inhibitor of protein tyrosine phosphatases (PTPs) |
Packinggroup: | III |
Sensitive: | Lachrymatory |
Usage: | A covalent inhibitor of protein tyrosine phosphatases (PTPs) |
Safety Data |
Hazard Symbols |
C: Corrosive
|
|
 |