| Identification | |
| Name: | Benzenamine,4-[2-(4-chlorophenyl)diazenyl]-N,N-dimethyl- |
| Synonyms: | Aniline,p-[(p-chlorophenyl)azo]-N,N-dimethyl- (6CI,7CI,8CI); Benzenamine,4-[(4-chlorophenyl)azo]-N,N-dimethyl- (9CI);4-(Dimethylamino)-4'-chloroazobenzene; 4-Chloro-4'-(dimethylamino)azobenzene;4-[(4-Chlorophenyl)azo]-N,N-dimethylaniline;4'-Chloro-4-dimethylaminoazobenzene; 4'-Chloro-N,N-dimethyl-4-aminoazobenzene |
| CAS: | 2491-76-1 |
| Molecular Formula: | C14H14 Cl N3 |
| Molecular Weight: | 259.76 |
| InChI: | InChI=1/C14H14ClN3/c1-18(2)14-9-7-13(8-10-14)17-16-12-5-3-11(15)4-6-12/h3-10H,1-2H3/b17-16+ |
| Molecular Structure: | ![(C14H14ClN3) Aniline,p-[(p-chlorophenyl)azo]-N,N-dimethyl- (6CI,7CI,8CI); Benzenamine,4-[(4-chlorophenyl)azo]-N,N...](https://img1.guidechem.com/chem/e/dict/34/2491-76-1.jpg) |
| Properties | |
| Melting Point: | 159 °C |
| Flash Point: | 198.2°C |
| Boiling Point: | 404.2°Cat760mmHg |
| Density: | 1.13g/cm3 |
| Refractive index: | 1.581 |
| Specification: |
p-Chloro-p'-dimethylaminoazobenzene , its cas register number is 2491-76-1. It also can be called p-Chlorodimethylaminoazobenzene ; 4'-Chloro-4-dimethylaminoazobenzene ; Aniline, N,N-dimethyl-p-((p-chlorophenyl)azo)- ; and N,N-Dimethyl-p-((p-chlorophenyl)azo)aniline . |
| Flash Point: | 198.2°C |
| Safety Data | |
 |
|
