| Identification | |
| Name: | Acetic acid, ethenyl ester, polymer with ethene |
| Synonyms: | Vinyl acetate, ethene polymer; |
| CAS: | 24937-78-8 |
| EINECS: | 429-840-1 |
| Molecular Formula: | (C2H4)x.(C4H6O2)y |
| Molecular Weight: | 114.143 |
| InChI: | InChI=1/C4H6O2.C2H4/c1-2-3-4(5)6;1-2/h2H,1,3H2,(H,5,6);1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, bases. |
| Appearance: | solid |
| Specification: |
? Acetic acid, ethenyl ester, polymer with ethene , its CAS NO. is 24937-78-8, the synonyms are Ethylene/VA copolymer ; Ethylenevinylacetate copolymer ; Ethylene, polymer with vinyl acetate . |
| Packinggroup: | Z01 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
