Identification |
Name: | 3-Cyanobenzaldehyde |
Synonyms: | 3-Formylbenzonitrile; m-Cyanobenzaldehyde |
CAS: | 24964-64-5 |
EINECS: | 246-549-1 |
Molecular Formula: | C8H5NO |
Molecular Weight: | 131.13 |
InChI: | InChI=1/C8H5NO/c9-5-7-2-1-3-8(4-7)6-10/h1-4,6H |
Molecular Structure: |
 |
Properties |
Transport: | 3439 |
Density: | 1.15g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.552 |
Water Solubility: | insoluble |
Solubility: | insoluble |
Appearance: | White to light yellow powder. |
Packinggroup: | III |
HS Code: | 29269095 |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Sensitive: | Air Sensitive |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |