| Identification | |
| Name: | 4-Hexen-3-one |
| Synonyms: | 2-Hexen-4-one;Ethyl 1-propenyl ketone; NSC 245483 |
| CAS: | 2497-21-4 |
| EINECS: | 219-681-2 |
| Molecular Formula: | C6H10 O |
| Molecular Weight: | 98.1430 |
| InChI: | InChI=1S/C6H10O/c1-3-5-6(7)4-2/h3,5H,4H2,1-2H3/b5-3+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1224 |
| Density: | 0.829 g/cm3 |
| Refractive index: | n20/D 1.44(lit.) |
| Water Solubility: | slightly soluble in water; soluble in oil |
| Solubility: | slightly soluble in water; soluble in oil |
| Appearance: | Colourless to yellow liquid |
| Specification: |
4-Hexen-3-one with CAS Registry Number of 2497-21-4 is clear colorless to yellow liquid, also known as 2-Hexen-4-one ; 2-Hexene-4-one ; 4-Hexene-3-one ; FEMA No. 3352 ; NSC 245483 . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
