| Identification | |
| Name: | Benz[a]anthracene,2-methyl- |
| Synonyms: | 2-Methylbenz[a]anthracene;NSC 409461 |
| CAS: | 2498-76-2 |
| Molecular Formula: | C19H14 |
| Molecular Weight: | 242.33 |
| InChI: | InChI=1/C19H14/c1-13-6-7-14-8-9-17-11-15-4-2-3-5-16(15)12-19(17)18(14)10-13/h2-12H,1H3 |
| Molecular Structure: | ![(C19H14) 2-Methylbenz[a]anthracene;NSC 409461](https://img1.guidechem.com/chem/e/dict/41/2498-76-2.jpg) |
| Properties | |
| Flash Point: | 217.8°C |
| Boiling Point: | 449.4°Cat760mmHg |
| Density: | 1.164g/cm3 |
| Refractive index: | 1.748 |
| Specification: |
2-Methylbenz(a)anthracene ,its cas register number is 2498-76-2. It also can be called 2'-Methyl-1,2-benzanthracene ; and Benz(a)anthracene, 2-methyl- . |
| Flash Point: | 217.8°C |
| Safety Data | |
 |
|
