| Identification |
| Name: | Benzene, ethenylmethyl- |
| Synonyms: | Styrene,ar-methyl- (8CI); Ethenylmethylbenzene; Methylstyrene; Tolylethylene;Vinyltoluene |
| CAS: | 25013-15-4 |
| EINECS: | 246-562-2 |
| Molecular Formula: | C9H10 |
| Molecular Weight: | 118.19 |
| InChI: | InChI=1/2C9H10/c1-3-9-6-4-8(2)5-7-9;1-3-9-6-4-5-8(2)7-9/h2*3-7H,1H2,2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2618 3/PG 3 |
| Melting Point: | -77 °C
|
| Flash Point: | 47.4°C |
| Boiling Point: | 169-172 °C(lit.)
|
| Density: | 0.890 |
| Stability: | Stable. Flammable. Incompatible with oxidizing agents, peroxides, strong acids, aluminium chloride. May contain small amounts of t-butylcatechol to inhibit polymerization. |
| Refractive index: | n20/D 1.5425(lit.) |
| Water Solubility: | 89 mg l-1 |
| Solubility: | 89mgl-1 |
| Appearance: | colourless liquid with a strong and unpleasant odour |
| Flash Point: | 47.4°C |
| Storage Temperature: | Refrigerator |
| Safety Data |
| |
 |
