| Identification | |
| Name: | 1-Pentanone,1-(4-chlorophenyl)- |
| Synonyms: | Valerophenone,4'-chloro- (6CI,7CI,8CI);1-(4-Chlorophenyl)-1-pentanone;1-(4-Chlorophenyl)pentan-1-one;4-Chlorophenyl butyl ketone;4'-Chlorovalerophenone;NSC 76591;p-Chlorovalerophenone; |
| CAS: | 25017-08-7 |
| EINECS: | 246-566-4 |
| Molecular Formula: | C11H13ClO |
| Molecular Weight: | 196.68 |
| InChI: | InChI=1/C11H13ClO/c1-2-3-4-11(13)9-5-7-10(12)8-6-9/h5-8H,2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.078 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5246 (35 C) |
| Appearance: | white solid |
| Specification: |
4-Chlorovalerophenone (CAS NO.25017-08-7), its Synonyms are 4'-Chlorovalerophenone ; P-Chlorovalerophenone ; 1-(4-Chlorophenyl)pentan-1-one ; 1-Pentanone, 1-(4-chlorophenyl)- ; 1-(4-Chlorophenyl)pentane-1-one . It is white to yellow crystalline low melting solid. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
